C30H27Cl2N3O6S — CID 126199791
2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 126199791) has the molecular formula C30H27Cl2N3O6S and a molecular weight of 628.53 g/mol. Its IUPAC name is 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 126199791 |
| Molecular Formula | C30H27Cl2N3O6S |
| Molecular Weight | 628.53 g/mol |
| Exact Mass | 627.10 |
| IUPAC Name | 2-[(5E)-5-[[2-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | COc1cccc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3N3CCOCC3)C2=O)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H27Cl2N3O6S/c1-39-25-8-4-5-19(28(25)41-18-20-9-10-21(31)16-22(20)32)15-26-29(37)35(30(38)42-26)17-27(36)33-23-6-2-3-7-24(23)34-11-13-40-14-12-34/h2-10,15-16H,11-14,17-18H2,1H3,(H,33,36)/b26-15+ |
| InChIKey | GQTRTMJHVZEBGZ-CVKSISIWSA-N |
| XLogP | 6.09 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|