C24H21N3O4S — CID 126242932
2-[(5E)-2,4-dioxo-5-[(1-prop-2-enylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 126242932) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is 2-[(5E)-2,4-dioxo-5-[(1-prop-2-enylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[(5E)-2,4-dioxo-5-[(1-prop-2-enylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126242932 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 2-[(5E)-2,4-dioxo-5-[(1-prop-2-enylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | C=CCn1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(OC)cc3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O4S/c1-3-12-26-14-16(19-6-4-5-7-20(19)26)13-21-23(29)27(24(30)32-21)15-22(28)25-17-8-10-18(31-2)11-9-17/h3-11,13-14H,1,12,15H2,2H3,(H,25,28)/b21-13+ |
| InChIKey | HEIUEOYUBDQWJG-FYJGNVAPSA-N |
| XLogP | 4.51 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|