C24H22ClN3O4S — CID 3532593
N-(3-chloro-4-methoxyphenyl)-2-[2,4-dioxo-5-[(1-propylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 3532593) has the molecular formula C24H22ClN3O4S and a molecular weight of 483.98 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[2,4-dioxo-5-[(1-propylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[2,4-dioxo-5-[(1-propylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 3532593 |
| Molecular Formula | C24H22ClN3O4S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[2,4-dioxo-5-[(1-propylindol-3-yl)methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCCn1cc(C=C2SC(=O)N(CC(=O)Nc3ccc(OC)c(Cl)c3)C2=O)c2ccccc21 |
| InChI | InChI=1S/C24H22ClN3O4S/c1-3-10-27-13-15(17-6-4-5-7-19(17)27)11-21-23(30)28(24(31)33-21)14-22(29)26-16-8-9-20(32-2)18(25)12-16/h4-9,11-13H,3,10,14H2,1-2H3,(H,26,29) |
| InChIKey | QADYCFIYLZCBBG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|