C28H22Cl2N2O2S — CID 126145138
(5Z)-3-benzyl-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 126145138) has the molecular formula C28H22Cl2N2O2S and a molecular weight of 521.47 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-benzyl-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126145138 |
| Molecular Formula | C28H22Cl2N2O2S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | (5Z)-3-benzyl-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(Cc4ccccc4)C3=O)cn(Cc3ccc(Cl)c(Cl)c3)c12 |
| InChI | InChI=1S/C28H22Cl2N2O2S/c1-2-20-9-6-10-22-21(17-31(26(20)22)15-19-11-12-23(29)24(30)13-19)14-25-27(33)32(28(34)35-25)16-18-7-4-3-5-8-18/h3-14,17H,2,15-16H2,1H3/b25-14- |
| InChIKey | IUFZGQLRZNCNNI-QFEZKATASA-N |
| XLogP | 7.80 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|