C22H18Cl2N2OS2 — CID 126139019
(5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126139019) has the molecular formula C22H18Cl2N2OS2 and a molecular weight of 461.44 g/mol. Its IUPAC name is (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126139019 |
| Molecular Formula | C22H18Cl2N2OS2 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 460.02 |
| IUPAC Name | (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3\SC(=S)N(C)C3=O)cn(Cc3ccc(Cl)c(Cl)c3)c12 |
| InChI | InChI=1S/C22H18Cl2N2OS2/c1-3-14-5-4-6-16-15(10-19-21(27)25(2)22(28)29-19)12-26(20(14)16)11-13-7-8-17(23)18(24)9-13/h4-10,12H,3,11H2,1-2H3/b19-10- |
| InChIKey | JUMLROQPSKCECR-GRSHGNNSSA-N |
| XLogP | 6.39 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|