C30H24Cl2N2O3S — CID 126140093
(5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 126140093) has the molecular formula C30H24Cl2N2O3S and a molecular weight of 563.51 g/mol. Its IUPAC name is (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126140093 |
| Molecular Formula | C30H24Cl2N2O3S |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-[2-(4-methylphenyl)-2-oxoethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCc1cccc2c(/C=C3\SC(=O)N(CC(=O)c4ccc(C)cc4)C3=O)cn(Cc3ccc(Cl)c(Cl)c3)c12 |
| InChI | InChI=1S/C30H24Cl2N2O3S/c1-3-20-5-4-6-23-22(16-33(28(20)23)15-19-9-12-24(31)25(32)13-19)14-27-29(36)34(30(37)38-27)17-26(35)21-10-7-18(2)8-11-21/h4-14,16H,3,15,17H2,1-2H3/b27-14- |
| InChIKey | SANGMCFCDZBUGA-VYYCAZPPSA-N |
| XLogP | 7.79 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|