C27H21Cl2N3OS — CID 126141596
(5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 126141596) has the molecular formula C27H21Cl2N3OS and a molecular weight of 506.46 g/mol. Its IUPAC name is (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 126141596 |
| Molecular Formula | C27H21Cl2N3OS |
| Molecular Weight | 506.46 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | (5Z)-5-[[1-[(3,4-dichlorophenyl)methyl]-7-ethylindol-3-yl]methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3\NC(=S)N(c4ccccc4)C3=O)cn(Cc3ccc(Cl)c(Cl)c3)c12 |
| InChI | InChI=1S/C27H21Cl2N3OS/c1-2-18-7-6-10-21-19(16-31(25(18)21)15-17-11-12-22(28)23(29)13-17)14-24-26(33)32(27(34)30-24)20-8-4-3-5-9-20/h3-14,16H,2,15H2,1H3,(H,30,34)/b24-14- |
| InChIKey | YGAYVAPSFPQZFX-OYKKKHCWSA-N |
| XLogP | 6.82 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.46 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|