C28H24FN3OS — CID 44714038
(5Z)-5-[[7-ethyl-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 44714038) has the molecular formula C28H24FN3OS and a molecular weight of 469.59 g/mol. Its IUPAC name is (5Z)-5-[[7-ethyl-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | (5Z)-5-[[7-ethyl-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 44714038 |
| Molecular Formula | C28H24FN3OS |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | (5Z)-5-[[7-ethyl-1-[(2-fluorophenyl)methyl]indol-3-yl]methylidene]-1-methyl-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CCc1cccc2c(/C=C3/C(=O)N(c4ccccc4)C(=S)N3C)cn(Cc3ccccc3F)c12 |
| InChI | InChI=1S/C28H24FN3OS/c1-3-19-11-9-14-23-21(18-31(26(19)23)17-20-10-7-8-15-24(20)29)16-25-27(33)32(28(34)30(25)2)22-12-5-4-6-13-22/h4-16,18H,3,17H2,1-2H3/b25-16- |
| InChIKey | RFOJHTAPQHZSAL-XYGWBWBKSA-N |
| XLogP | 6.00 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|