C18H18Cl2N2O5S — CID 126216337
2-[(5Z)-5-[(3,5-dichloro-2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide (PubChem CID 126216337) has the molecular formula C18H18Cl2N2O5S and a molecular weight of 445.32 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3,5-dichloro-2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide.
| Compound Name | 2-[(5Z)-5-[(3,5-dichloro-2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 126216337 |
| Molecular Formula | C18H18Cl2N2O5S |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2-[(5Z)-5-[(3,5-dichloro-2-methoxyphenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[[(2S)-oxolan-2-yl]methyl]acetamide |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=C1\SC(=O)N(CC(=O)NC[C@@H]2CCCO2)C1=O |
| InChI | InChI=1S/C18H18Cl2N2O5S/c1-26-16-10(5-11(19)7-13(16)20)6-14-17(24)22(18(25)28-14)9-15(23)21-8-12-3-2-4-27-12/h5-7,12H,2-4,8-9H2,1H3,(H,21,23)/b14-6-/t12-/m0/s1 |
| InChIKey | DXBLMJGKWZOUEF-JVXNRYDGSA-N |
| XLogP | 3.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_B(16)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|