C17H15ClN2O3 — CID 28863817
(2E)-6-amino-2-[(4-chlorophenyl)methylidene]-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one (PubChem CID 28863817) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is (2E)-6-amino-2-[(4-chlorophenyl)methylidene]-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one.
| Compound Name | (2E)-6-amino-2-[(4-chlorophenyl)methylidene]-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28863817 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | (2E)-6-amino-2-[(4-chlorophenyl)methylidene]-4-(2-hydroxyethyl)-1,4-benzoxazin-3-one |
| SMILES | Nc1ccc2c(c1)N(CCO)C(=O)/C(=C\c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C17H15ClN2O3/c18-12-3-1-11(2-4-12)9-16-17(22)20(7-8-21)14-10-13(19)5-6-15(14)23-16/h1-6,9-10,21H,7-8,19H2/b16-9+ |
| InChIKey | KIYCCDOFXXVNQL-CXUHLZMHSA-N |
| XLogP | 2.68 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|