C23H25BrN3O4+ — CID 4070216
2-[2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-morpholin-4-ium-4-ylethyl)acetamide (PubChem CID 4070216) has the molecular formula C23H25BrN3O4+ and a molecular weight of 487.37 g/mol. Its IUPAC name is 2-[2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-morpholin-4-ium-4-ylethyl)acetamide.
| Compound Name | 2-[2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 4070216 |
| Molecular Formula | C23H25BrN3O4+ |
| Molecular Weight | 487.37 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | 2-[2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=Cc2cccc(Br)c2)Oc2ccccc21)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C23H24BrN3O4/c24-18-5-3-4-17(14-18)15-21-23(29)27(19-6-1-2-7-20(19)31-21)16-22(28)25-8-9-26-10-12-30-13-11-26/h1-7,14-15H,8-13,16H2,(H,25,28)/p+1 |
| InChIKey | RNOPFUQOURVBIP-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|