C26H31FN3O3+ — CID 4090726
2-[2-[(3-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[3-(3-methylpiperidin-1-ium-1-yl)propyl]acetamide (PubChem CID 4090726) has the molecular formula C26H31FN3O3+ and a molecular weight of 452.55 g/mol. Its IUPAC name is 2-[2-[(3-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[3-(3-methylpiperidin-1-ium-1-yl)propyl]acetamide.
| Compound Name | 2-[2-[(3-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[3-(3-methylpiperidin-1-ium-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 4090726 |
| Molecular Formula | C26H31FN3O3+ |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 2-[2-[(3-fluorophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]-N-[3-(3-methylpiperidin-1-ium-1-yl)propyl]acetamide |
| SMILES | CC1CCC[NH+](CCCNC(=O)CN2C(=O)C(=Cc3cccc(F)c3)Oc3ccccc32)C1 |
| InChI | InChI=1S/C26H30FN3O3/c1-19-7-5-13-29(17-19)14-6-12-28-25(31)18-30-22-10-2-3-11-23(22)33-24(26(30)32)16-20-8-4-9-21(27)15-20/h2-4,8-11,15-16,19H,5-7,12-14,17-18H2,1H3,(H,28,31)/p+1 |
| InChIKey | JYHWUXJCKNJIFU-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|