C19H20N2O3 — CID 28864361
(2E)-4-(3-aminopropyl)-2-[(3-methoxyphenyl)methylidene]-1,4-benzoxazin-3-one (PubChem CID 28864361) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2E)-4-(3-aminopropyl)-2-[(3-methoxyphenyl)methylidene]-1,4-benzoxazin-3-one.
| Compound Name | (2E)-4-(3-aminopropyl)-2-[(3-methoxyphenyl)methylidene]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28864361 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2E)-4-(3-aminopropyl)-2-[(3-methoxyphenyl)methylidene]-1,4-benzoxazin-3-one |
| SMILES | COc1cccc(/C=C2/Oc3ccccc3N(CCCN)C2=O)c1 |
| InChI | InChI=1S/C19H20N2O3/c1-23-15-7-4-6-14(12-15)13-18-19(22)21(11-5-10-20)16-8-2-3-9-17(16)24-18/h2-4,6-9,12-13H,5,10-11,20H2,1H3/b18-13+ |
| InChIKey | OPOJMIXMDRPSHA-QGOAFFKASA-N |
| XLogP | 2.81 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|