C19H20N2O4 — CID 28864372
(2E)-7-amino-4-(3-hydroxypropyl)-2-[(3-methoxyphenyl)methylidene]-1,4-benzoxazin-3-one (PubChem CID 28864372) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (2E)-7-amino-4-(3-hydroxypropyl)-2-[(3-methoxyphenyl)methylidene]-1,4-benzoxazin-3-one.
| Compound Name | (2E)-7-amino-4-(3-hydroxypropyl)-2-[(3-methoxyphenyl)methylidene]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28864372 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2E)-7-amino-4-(3-hydroxypropyl)-2-[(3-methoxyphenyl)methylidene]-1,4-benzoxazin-3-one |
| SMILES | COc1cccc(/C=C2/Oc3cc(N)ccc3N(CCCO)C2=O)c1 |
| InChI | InChI=1S/C19H20N2O4/c1-24-15-5-2-4-13(10-15)11-18-19(23)21(8-3-9-22)16-7-6-14(20)12-17(16)25-18/h2,4-7,10-12,22H,3,8-9,20H2,1H3/b18-11+ |
| InChIKey | YELPRJALKJKRHJ-WOJGMQOQSA-N |
| XLogP | 2.43 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|