C20H22N2O2 — CID 28863996
(2E)-4-(3-aminopropyl)-6-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzoxazin-3-one (PubChem CID 28863996) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (2E)-4-(3-aminopropyl)-6-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzoxazin-3-one.
| Compound Name | (2E)-4-(3-aminopropyl)-6-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28863996 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (2E)-4-(3-aminopropyl)-6-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(/C=C2/Oc3ccc(C)cc3N(CCCN)C2=O)c1 |
| InChI | InChI=1S/C20H22N2O2/c1-14-5-3-6-16(11-14)13-19-20(23)22(10-4-9-21)17-12-15(2)7-8-18(17)24-19/h3,5-8,11-13H,4,9-10,21H2,1-2H3/b19-13+ |
| InChIKey | CNVAHSGAZASBJF-CPNJWEJPSA-N |
| XLogP | 3.42 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|