C25H23N3O2S — CID 46251078
2-[(2E)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 46251078) has the molecular formula C25H23N3O2S and a molecular weight of 429.55 g/mol. Its IUPAC name is 2-[(2E)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(2E)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46251078 |
| Molecular Formula | C25H23N3O2S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 2-[(2E)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CCc1ccc(/C=C2/Sc3ccccc3N(CC(=O)NCc3cccnc3)C2=O)cc1 |
| InChI | InChI=1S/C25H23N3O2S/c1-2-18-9-11-19(12-10-18)14-23-25(30)28(21-7-3-4-8-22(21)31-23)17-24(29)27-16-20-6-5-13-26-15-20/h3-15H,2,16-17H2,1H3,(H,27,29)/b23-14+ |
| InChIKey | CKLXXSSWJKZZJD-OEAKJJBVSA-N |
| XLogP | 4.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|