C27H26N2O3S — CID 3528980
2-[2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 3528980) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is 2-[2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 3528980 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | CCc1ccc(C=C2Sc3ccccc3N(CC(=O)NCc3ccccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C27H26N2O3S/c1-3-19-12-14-20(15-13-19)16-25-27(31)29(22-9-5-7-11-24(22)33-25)18-26(30)28-17-21-8-4-6-10-23(21)32-2/h4-16H,3,17-18H2,1-2H3,(H,28,30) |
| InChIKey | QSTHWZXGQAJHLK-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|