C25H33NO4S — CID 145124376
(5Z)-3-[(2,3-dimethoxyphenyl)methyl]-5-[(4-ethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione;ethane (PubChem CID 145124376) has the molecular formula C25H33NO4S and a molecular weight of 443.61 g/mol. Its IUPAC name is (5Z)-3-[(2,3-dimethoxyphenyl)methyl]-5-[(4-ethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione;ethane.
| Compound Name | (5Z)-3-[(2,3-dimethoxyphenyl)methyl]-5-[(4-ethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione;ethane |
|---|---|
| PubChem CID | 145124376 |
| Molecular Formula | C25H33NO4S |
| Molecular Weight | 443.61 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | (5Z)-3-[(2,3-dimethoxyphenyl)methyl]-5-[(4-ethylphenyl)methylidene]-1,3-thiazolidine-2,4-dione;ethane |
| SMILES | CC.CC.CCc1ccc(/C=C2\SC(=O)N(Cc3cccc(OC)c3OC)C2=O)cc1 |
| InChI | InChI=1S/C21H21NO4S.2C2H6/c1-4-14-8-10-15(11-9-14)12-18-20(23)22(21(24)27-18)13-16-6-5-7-17(25-2)19(16)26-3;2*1-2/h5-12H,4,13H2,1-3H3;2*1-2H3/b18-12-;; |
| InChIKey | XRVLDTLAQYCZRL-BRZJQQEKSA-N |
| XLogP | 6.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|