C17H15N5O5 — CID 28863906
2-[(2E)-7-amino-2-[(4-nitrophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide (PubChem CID 28863906) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-[(2E)-7-amino-2-[(4-nitrophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide.
| Compound Name | 2-[(2E)-7-amino-2-[(4-nitrophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 28863906 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-[(2E)-7-amino-2-[(4-nitrophenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]acetohydrazide |
| SMILES | NNC(=O)CN1C(=O)/C(=C\c2ccc([N+](=O)[O-])cc2)Oc2cc(N)ccc21 |
| InChI | InChI=1S/C17H15N5O5/c18-11-3-6-13-14(8-11)27-15(17(24)21(13)9-16(23)20-19)7-10-1-4-12(5-2-10)22(25)26/h1-8H,9,18-19H2,(H,20,23)/b15-7+ |
| InChIKey | DCPHDQLUWLGTOY-VIZOYTHASA-N |
| XLogP | 0.93 |
| TPSA | 153.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|