C16H13NO4S — CID 28862225
2-[(2E)-6-methyl-3-oxo-2-(thiophen-2-ylmethylidene)-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 28862225) has the molecular formula C16H13NO4S and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[(2E)-6-methyl-3-oxo-2-(thiophen-2-ylmethylidene)-1,4-benzoxazin-4-yl]acetic acid.
| Compound Name | 2-[(2E)-6-methyl-3-oxo-2-(thiophen-2-ylmethylidene)-1,4-benzoxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 28862225 |
| Molecular Formula | C16H13NO4S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[(2E)-6-methyl-3-oxo-2-(thiophen-2-ylmethylidene)-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | Cc1ccc2c(c1)N(CC(=O)O)C(=O)/C(=C\c1cccs1)O2 |
| InChI | InChI=1S/C16H13NO4S/c1-10-4-5-13-12(7-10)17(9-15(18)19)16(20)14(21-13)8-11-3-2-6-22-11/h2-8H,9H2,1H3,(H,18,19)/b14-8+ |
| InChIKey | UZJHDLSGXDERPG-RIYZIHGNSA-N |
| XLogP | 2.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|