C21H21NO4 — CID 28863382
2-[(2E)-6-methyl-3-oxo-2-[(4-propan-2-ylphenyl)methylidene]-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 28863382) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 2-[(2E)-6-methyl-3-oxo-2-[(4-propan-2-ylphenyl)methylidene]-1,4-benzoxazin-4-yl]acetic acid.
| Compound Name | 2-[(2E)-6-methyl-3-oxo-2-[(4-propan-2-ylphenyl)methylidene]-1,4-benzoxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 28863382 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 2-[(2E)-6-methyl-3-oxo-2-[(4-propan-2-ylphenyl)methylidene]-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | Cc1ccc2c(c1)N(CC(=O)O)C(=O)/C(=C\c1ccc(C(C)C)cc1)O2 |
| InChI | InChI=1S/C21H21NO4/c1-13(2)16-7-5-15(6-8-16)11-19-21(25)22(12-20(23)24)17-10-14(3)4-9-18(17)26-19/h4-11,13H,12H2,1-3H3,(H,23,24)/b19-11+ |
| InChIKey | LYQJGLOTFOBQHZ-YBFXNURJSA-N |
| XLogP | 3.97 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|