C19H17NO4 — CID 28863327
3-[(2E)-2-[(4-methylphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]propanoic acid (PubChem CID 28863327) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 3-[(2E)-2-[(4-methylphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]propanoic acid.
| Compound Name | 3-[(2E)-2-[(4-methylphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 28863327 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-[(2E)-2-[(4-methylphenyl)methylidene]-3-oxo-1,4-benzoxazin-4-yl]propanoic acid |
| SMILES | Cc1ccc(/C=C2/Oc3ccccc3N(CCC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C19H17NO4/c1-13-6-8-14(9-7-13)12-17-19(23)20(11-10-18(21)22)15-4-2-3-5-16(15)24-17/h2-9,12H,10-11H2,1H3,(H,21,22)/b17-12+ |
| InChIKey | WCXORSRRJCRFAE-SFQUDFHCSA-N |
| XLogP | 3.24 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|