C19H14N2O5S — CID 28862159
2-[(2E)-2-(furan-2-ylmethylidene)-6-(2-methyl-1,3-thiazol-4-yl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid (PubChem CID 28862159) has the molecular formula C19H14N2O5S and a molecular weight of 382.40 g/mol. Its IUPAC name is 2-[(2E)-2-(furan-2-ylmethylidene)-6-(2-methyl-1,3-thiazol-4-yl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid.
| Compound Name | 2-[(2E)-2-(furan-2-ylmethylidene)-6-(2-methyl-1,3-thiazol-4-yl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 28862159 |
| Molecular Formula | C19H14N2O5S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | 2-[(2E)-2-(furan-2-ylmethylidene)-6-(2-methyl-1,3-thiazol-4-yl)-3-oxo-1,4-benzoxazin-4-yl]acetic acid |
| SMILES | Cc1nc(-c2ccc3c(c2)N(CC(=O)O)C(=O)/C(=C\c2ccco2)O3)cs1 |
| InChI | InChI=1S/C19H14N2O5S/c1-11-20-14(10-27-11)12-4-5-16-15(7-12)21(9-18(22)23)19(24)17(26-16)8-13-3-2-6-25-13/h2-8,10H,9H2,1H3,(H,22,23)/b17-8+ |
| InChIKey | PGLBZEHISLLZIU-CAOOACKPSA-N |
| XLogP | 3.56 |
| TPSA | 92.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|