C20H17N3O2S — CID 28863158
(2E)-6-(2-amino-1,3-thiazol-4-yl)-4-methyl-2-[(4-methylphenyl)methylidene]-1,4-benzoxazin-3-one (PubChem CID 28863158) has the molecular formula C20H17N3O2S and a molecular weight of 363.44 g/mol. Its IUPAC name is (2E)-6-(2-amino-1,3-thiazol-4-yl)-4-methyl-2-[(4-methylphenyl)methylidene]-1,4-benzoxazin-3-one.
| Compound Name | (2E)-6-(2-amino-1,3-thiazol-4-yl)-4-methyl-2-[(4-methylphenyl)methylidene]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28863158 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2E)-6-(2-amino-1,3-thiazol-4-yl)-4-methyl-2-[(4-methylphenyl)methylidene]-1,4-benzoxazin-3-one |
| SMILES | Cc1ccc(/C=C2/Oc3ccc(-c4csc(N)n4)cc3N(C)C2=O)cc1 |
| InChI | InChI=1S/C20H17N3O2S/c1-12-3-5-13(6-4-12)9-18-19(24)23(2)16-10-14(7-8-17(16)25-18)15-11-26-20(21)22-15/h3-11H,1-2H3,(H2,21,22)/b18-9+ |
| InChIKey | LFFFESHZNWEABB-GIJQJNRQSA-N |
| XLogP | 4.10 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|