C12H13N3S — CID 138751510
4-(1-methyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-amine (PubChem CID 138751510) has the molecular formula C12H13N3S and a molecular weight of 231.32 g/mol. Its IUPAC name is 4-(1-methyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-amine.
| Compound Name | 4-(1-methyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 138751510 |
| Molecular Formula | C12H13N3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-(1-methyl-2,3-dihydroindol-6-yl)-1,3-thiazol-2-amine |
| SMILES | CN1CCc2ccc(-c3csc(N)n3)cc21 |
| InChI | InChI=1S/C12H13N3S/c1-15-5-4-8-2-3-9(6-11(8)15)10-7-16-12(13)14-10/h2-3,6-7H,4-5H2,1H3,(H2,13,14) |
| InChIKey | ZYANLZVSRJYSQE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |