C10H11N5 — CID 121385737
1-methyl-6-(2H-tetrazol-5-yl)-2,3-dihydroindole (PubChem CID 121385737) has the molecular formula C10H11N5 and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-methyl-6-(2H-tetrazol-5-yl)-2,3-dihydroindole.
| Compound Name | 1-methyl-6-(2H-tetrazol-5-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 121385737 |
| Molecular Formula | C10H11N5 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 1-methyl-6-(2H-tetrazol-5-yl)-2,3-dihydroindole |
| SMILES | CN1CCc2ccc(-c3nn[nH]n3)cc21 |
| InChI | InChI=1S/C10H11N5/c1-15-5-4-7-2-3-8(6-9(7)15)10-11-13-14-12-10/h2-3,6H,4-5H2,1H3,(H,11,12,13,14) |
| InChIKey | DYALGYSYJZJIPP-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |