C9H10BrN — CID 13098380
6-bromo-1-methyl-2,3-dihydroindole (PubChem CID 13098380) has the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. Its IUPAC name is 6-bromo-1-methyl-2,3-dihydroindole.
| Compound Name | 6-bromo-1-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 13098380 |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 6-bromo-1-methyl-2,3-dihydroindole |
| SMILES | CN1CCc2ccc(Br)cc21 |
| InChI | InChI=1S/C9H10BrN/c1-11-5-4-7-2-3-8(10)6-9(7)11/h2-3,6H,4-5H2,1H3 |
| InChIKey | KXJIMNJESWOULY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |