C9H9BrClN — CID 82622881
5-bromo-6-chloro-1-methyl-2,3-dihydroindole (PubChem CID 82622881) has the molecular formula C9H9BrClN and a molecular weight of 246.53 g/mol. Its IUPAC name is 5-bromo-6-chloro-1-methyl-2,3-dihydroindole.
| Compound Name | 5-bromo-6-chloro-1-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 82622881 |
| Molecular Formula | C9H9BrClN |
| Molecular Weight | 246.53 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | 5-bromo-6-chloro-1-methyl-2,3-dihydroindole |
| SMILES | CN1CCc2cc(Br)c(Cl)cc21 |
| InChI | InChI=1S/C9H9BrClN/c1-12-3-2-6-4-7(10)8(11)5-9(6)12/h4-5H,2-3H2,1H3 |
| InChIKey | SAZWHBMYCHEJDK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |