C10H13BrN2 — CID 82387671
6-bromo-1-methyl-3,4-dihydro-2H-quinolin-7-amine (PubChem CID 82387671) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 6-bromo-1-methyl-3,4-dihydro-2H-quinolin-7-amine.
| Compound Name | 6-bromo-1-methyl-3,4-dihydro-2H-quinolin-7-amine |
|---|---|
| PubChem CID | 82387671 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 6-bromo-1-methyl-3,4-dihydro-2H-quinolin-7-amine |
| SMILES | CN1CCCc2cc(Br)c(N)cc21 |
| InChI | InChI=1S/C10H13BrN2/c1-13-4-2-3-7-5-8(11)9(12)6-10(7)13/h5-6H,2-4,12H2,1H3 |
| InChIKey | WFNRTYBQFLIPTO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|