C12H18FN — CID 145098323
ethane;7-fluoro-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 145098323) has the molecular formula C12H18FN and a molecular weight of 195.28 g/mol. Its IUPAC name is ethane;7-fluoro-1-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | ethane;7-fluoro-1-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 145098323 |
| Molecular Formula | C12H18FN |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | ethane;7-fluoro-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CC.CN1CCCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H12FN.C2H6/c1-12-6-2-3-8-4-5-9(11)7-10(8)12;1-2/h4-5,7H,2-3,6H2,1H3;1-2H3 |
| InChIKey | ILVPAJWFNGZJJJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |