C12H18N2O — CID 117295178
O-[2-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)ethyl]hydroxylamine (PubChem CID 117295178) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is O-[2-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)ethyl]hydroxylamine.
| Compound Name | O-[2-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117295178 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | O-[2-(1-methyl-3,4-dihydro-2H-quinolin-7-yl)ethyl]hydroxylamine |
| SMILES | CN1CCCc2ccc(CCON)cc21 |
| InChI | InChI=1S/C12H18N2O/c1-14-7-2-3-11-5-4-10(6-8-15-13)9-12(11)14/h4-5,9H,2-3,6-8,13H2,1H3 |
| InChIKey | GBZSAGJRZFNWQJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|