C10H12FN — CID 129259469
7-fluoro-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 129259469) has the molecular formula C10H12FN and a molecular weight of 165.21 g/mol. Its IUPAC name is 7-fluoro-1-methyl-3,4-dihydro-2H-quinoline.
| Compound Name | 7-fluoro-1-methyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 129259469 |
| Molecular Formula | C10H12FN |
| Molecular Weight | 165.21 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | 7-fluoro-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CN1CCCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H12FN/c1-12-6-2-3-8-4-5-9(11)7-10(8)12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | XWSVZWKURPHOQS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |