C11H11N — CID 130132980
6-ethynyl-1-methyl-2,3-dihydroindole (PubChem CID 130132980) has the molecular formula C11H11N and a molecular weight of 157.22 g/mol. Its IUPAC name is 6-ethynyl-1-methyl-2,3-dihydroindole.
| Compound Name | 6-ethynyl-1-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 130132980 |
| Molecular Formula | C11H11N |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 6-ethynyl-1-methyl-2,3-dihydroindole |
| SMILES | C#Cc1ccc2c(c1)N(C)CC2 |
| InChI | InChI=1S/C11H11N/c1-3-9-4-5-10-6-7-12(2)11(10)8-9/h1,4-5,8H,6-7H2,2H3 |
| InChIKey | SCDAIGPDSACDLJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|