C12H16N2O — CID 134369280
N,N,1-trimethyl-2,3-dihydroindole-6-carboxamide (PubChem CID 134369280) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is N,N,1-trimethyl-2,3-dihydroindole-6-carboxamide.
| Compound Name | N,N,1-trimethyl-2,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 134369280 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | N,N,1-trimethyl-2,3-dihydroindole-6-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2c(c1)N(C)CC2 |
| InChI | InChI=1S/C12H16N2O/c1-13(2)12(15)10-5-4-9-6-7-14(3)11(9)8-10/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | GILXBJSXTDIJER-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |