C13H18N2O — CID 144672537
1-ethyl-N,N-dimethyl-2,3-dihydroindole-6-carboxamide (PubChem CID 144672537) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-ethyl-N,N-dimethyl-2,3-dihydroindole-6-carboxamide.
| Compound Name | 1-ethyl-N,N-dimethyl-2,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 144672537 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 1-ethyl-N,N-dimethyl-2,3-dihydroindole-6-carboxamide |
| SMILES | CCN1CCc2ccc(C(=O)N(C)C)cc21 |
| InChI | InChI=1S/C13H18N2O/c1-4-15-8-7-10-5-6-11(9-12(10)15)13(16)14(2)3/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | SMKRTYBTBPHGFW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |