C23H18ClN3OS — CID 11235487
(5Z)-3-anilino-2-benzylsulfanyl-5-[(4-chlorophenyl)methylidene]imidazol-4-one (PubChem CID 11235487) has the molecular formula C23H18ClN3OS and a molecular weight of 419.94 g/mol. Its IUPAC name is (5Z)-3-anilino-2-benzylsulfanyl-5-[(4-chlorophenyl)methylidene]imidazol-4-one.
| Compound Name | (5Z)-3-anilino-2-benzylsulfanyl-5-[(4-chlorophenyl)methylidene]imidazol-4-one |
|---|---|
| PubChem CID | 11235487 |
| Molecular Formula | C23H18ClN3OS |
| Molecular Weight | 419.94 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (5Z)-3-anilino-2-benzylsulfanyl-5-[(4-chlorophenyl)methylidene]imidazol-4-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2)N=C(SCc2ccccc2)N1Nc1ccccc1 |
| InChI | InChI=1S/C23H18ClN3OS/c24-19-13-11-17(12-14-19)15-21-22(28)27(26-20-9-5-2-6-10-20)23(25-21)29-16-18-7-3-1-4-8-18/h1-15,26H,16H2/b21-15- |
| InChIKey | XAFLJUBYDIEOIH-QNGOZBTKSA-N |
| XLogP | 5.84 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.94 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|