C26H19ClN4O2S — CID 19058775
2-[(4Z)-4-[(4-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(1H-indol-6-yl)acetamide (PubChem CID 19058775) has the molecular formula C26H19ClN4O2S and a molecular weight of 486.98 g/mol. Its IUPAC name is 2-[(4Z)-4-[(4-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(1H-indol-6-yl)acetamide.
| Compound Name | 2-[(4Z)-4-[(4-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(1H-indol-6-yl)acetamide |
|---|---|
| PubChem CID | 19058775 |
| Molecular Formula | C26H19ClN4O2S |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | 2-[(4Z)-4-[(4-chlorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(1H-indol-6-yl)acetamide |
| SMILES | O=C(CSC1=N/C(=C\c2ccc(Cl)cc2)C(=O)N1c1ccccc1)Nc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C26H19ClN4O2S/c27-19-9-6-17(7-10-19)14-23-25(33)31(21-4-2-1-3-5-21)26(30-23)34-16-24(32)29-20-11-8-18-12-13-28-22(18)15-20/h1-15,28H,16H2,(H,29,32)/b23-14- |
| InChIKey | GTBQKSMFFKNZMS-UCQKPKSFSA-N |
| XLogP | 5.94 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|