C29H29N3O6S — CID 125117520
N-(2-methoxyphenyl)-3-[(4E)-5-oxo-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanylpropanamide (PubChem CID 125117520) has the molecular formula C29H29N3O6S and a molecular weight of 547.63 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3-[(4E)-5-oxo-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanylpropanamide.
| Compound Name | N-(2-methoxyphenyl)-3-[(4E)-5-oxo-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 125117520 |
| Molecular Formula | C29H29N3O6S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.18 |
| IUPAC Name | N-(2-methoxyphenyl)-3-[(4E)-5-oxo-1-phenyl-4-[(3,4,5-trimethoxyphenyl)methylidene]imidazol-2-yl]sulfanylpropanamide |
| SMILES | COc1ccccc1NC(=O)CCSC1=N/C(=C/c2cc(OC)c(OC)c(OC)c2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C29H29N3O6S/c1-35-23-13-9-8-12-21(23)30-26(33)14-15-39-29-31-22(28(34)32(29)20-10-6-5-7-11-20)16-19-17-24(36-2)27(38-4)25(18-19)37-3/h5-13,16-18H,14-15H2,1-4H3,(H,30,33)/b22-16+ |
| InChIKey | GFCGUBGULKGHIC-CJLVFECKSA-N |
| XLogP | 5.23 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|