C23H19ClFN5O4S — CID 53295768
(1E)-2-[(4Z)-4-[(2-chloro-6-fluorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate (PubChem CID 53295768) has the molecular formula C23H19ClFN5O4S and a molecular weight of 515.95 g/mol. Its IUPAC name is (1E)-2-[(4Z)-4-[(2-chloro-6-fluorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate.
| Compound Name | (1E)-2-[(4Z)-4-[(2-chloro-6-fluorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate |
|---|---|
| PubChem CID | 53295768 |
| Molecular Formula | C23H19ClFN5O4S |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | (1E)-2-[(4Z)-4-[(2-chloro-6-fluorophenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]ethanimidate |
| SMILES | COCC[n+]1cc(/N=C(/[O-])CSC2=N/C(=C\c3c(F)cccc3Cl)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C23H19ClFN5O4S/c1-33-11-10-29-13-21(34-28-29)27-20(31)14-35-23-26-19(12-16-17(24)8-5-9-18(16)25)22(32)30(23)15-6-3-2-4-7-15/h2-9,12-13H,10-11,14H2,1H3/b19-12- |
| InChIKey | KHNKDTXSAHLUTJ-UNOMPAQXSA-N |
| XLogP | 2.97 |
| TPSA | 107.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|