C22H20N6O4S — CID 53295698
(1E)-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-[(4E)-5-oxo-1-phenyl-4-(pyridin-4-ylmethylidene)imidazol-2-yl]sulfanylethanimidate (PubChem CID 53295698) has the molecular formula C22H20N6O4S and a molecular weight of 464.51 g/mol. Its IUPAC name is (1E)-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-[(4E)-5-oxo-1-phenyl-4-(pyridin-4-ylmethylidene)imidazol-2-yl]sulfanylethanimidate.
| Compound Name | (1E)-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-[(4E)-5-oxo-1-phenyl-4-(pyridin-4-ylmethylidene)imidazol-2-yl]sulfanylethanimidate |
|---|---|
| PubChem CID | 53295698 |
| Molecular Formula | C22H20N6O4S |
| Molecular Weight | 464.51 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | (1E)-N-[3-(2-methoxyethyl)oxadiazol-3-ium-5-yl]-2-[(4E)-5-oxo-1-phenyl-4-(pyridin-4-ylmethylidene)imidazol-2-yl]sulfanylethanimidate |
| SMILES | COCC[n+]1cc(/N=C(/[O-])CSC2=N/C(=C/c3ccncc3)C(=O)N2c2ccccc2)on1 |
| InChI | InChI=1S/C22H20N6O4S/c1-31-12-11-27-14-20(32-26-27)25-19(29)15-33-22-24-18(13-16-7-9-23-10-8-16)21(30)28(22)17-5-3-2-4-6-17/h2-10,13-14H,11-12,15H2,1H3/b18-13+ |
| InChIKey | CRRADAMVXRMWGS-QGOAFFKASA-N |
| XLogP | 1.57 |
| TPSA | 120.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.51 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|