C27H28N6O4S — CID 53295288
(1E)-2-[(4E)-4-[(4-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate (PubChem CID 53295288) has the molecular formula C27H28N6O4S and a molecular weight of 532.63 g/mol. Its IUPAC name is (1E)-2-[(4E)-4-[(4-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate.
| Compound Name | (1E)-2-[(4E)-4-[(4-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate |
|---|---|
| PubChem CID | 53295288 |
| Molecular Formula | C27H28N6O4S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | (1E)-2-[(4E)-4-[(4-ethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-piperidin-1-yloxadiazol-3-ium-5-yl)ethanimidate |
| SMILES | CCOc1ccc(/C=C2/N=C(SC/C([O-])=N\c3c[n+](N4CCCCC4)no3)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H28N6O4S/c1-2-36-22-13-11-20(12-14-22)17-23-26(35)33(21-9-5-3-6-10-21)27(28-23)38-19-24(34)29-25-18-32(30-37-25)31-15-7-4-8-16-31/h3,5-6,9-14,17-18H,2,4,7-8,15-16,19H2,1H3/b23-17+ |
| InChIKey | OIZSCTWNOZNDFX-HAVVHWLPSA-N |
| XLogP | 3.05 |
| TPSA | 110.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|