C23H21N5O5S — CID 53293931
(1E)-2-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-methyloxadiazol-3-ium-5-yl)ethanimidate (PubChem CID 53293931) has the molecular formula C23H21N5O5S and a molecular weight of 479.52 g/mol. Its IUPAC name is (1E)-2-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-methyloxadiazol-3-ium-5-yl)ethanimidate.
| Compound Name | (1E)-2-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-methyloxadiazol-3-ium-5-yl)ethanimidate |
|---|---|
| PubChem CID | 53293931 |
| Molecular Formula | C23H21N5O5S |
| Molecular Weight | 479.52 g/mol |
| Exact Mass | 479.13 |
| IUPAC Name | (1E)-2-[(4E)-4-[(2,3-dimethoxyphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanyl-N-(3-methyloxadiazol-3-ium-5-yl)ethanimidate |
| SMILES | COc1cccc(/C=C2/N=C(SC/C([O-])=N\c3c[n+](C)no3)N(c3ccccc3)C2=O)c1OC |
| InChI | InChI=1S/C23H21N5O5S/c1-27-13-20(33-26-27)25-19(29)14-34-23-24-17(22(30)28(23)16-9-5-4-6-10-16)12-15-8-7-11-18(31-2)21(15)32-3/h4-13H,14H2,1-3H3/b17-12+ |
| InChIKey | RHOBZUBKEKBYBH-SFQUDFHCSA-N |
| XLogP | 2.08 |
| TPSA | 116.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|