C27H21N4O4S+ — CID 53290647
4-[2-[(4E)-4-[(3-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-phenyl-2H-oxadiazol-3-ium-5-one (PubChem CID 53290647) has the molecular formula C27H21N4O4S+ and a molecular weight of 497.56 g/mol. Its IUPAC name is 4-[2-[(4E)-4-[(3-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-phenyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[2-[(4E)-4-[(3-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-phenyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53290647 |
| Molecular Formula | C27H21N4O4S+ |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-[2-[(4E)-4-[(3-methylphenyl)methylidene]-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-phenyl-2H-oxadiazol-3-ium-5-one |
| SMILES | Cc1cccc(/C=C2/N=C(SCC(=O)c3c(=O)o[nH][n+]3-c3ccccc3)N(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C27H20N4O4S/c1-18-9-8-10-19(15-18)16-22-25(33)30(20-11-4-2-5-12-20)27(28-22)36-17-23(32)24-26(34)35-29-31(24)21-13-6-3-7-14-21/h2-16H,17H2,1H3/p+1/b22-16+ |
| InChIKey | FNKKPTUVTMEAAE-CJLVFECKSA-O |
| XLogP | 3.91 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|