C27H19N4O6S+ — CID 53290831
4-[2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-phenyl-2H-oxadiazol-3-ium-5-one (PubChem CID 53290831) has the molecular formula C27H19N4O6S+ and a molecular weight of 527.54 g/mol. Its IUPAC name is 4-[2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-phenyl-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-phenyl-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 53290831 |
| Molecular Formula | C27H19N4O6S+ |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | 4-[2-[(4E)-4-(1,3-benzodioxol-5-ylmethylidene)-5-oxo-1-phenylimidazol-2-yl]sulfanylacetyl]-3-phenyl-2H-oxadiazol-3-ium-5-one |
| SMILES | O=C(CSC1=N/C(=C/c2ccc3c(c2)OCO3)C(=O)N1c1ccccc1)c1c(=O)o[nH][n+]1-c1ccccc1 |
| InChI | InChI=1S/C27H18N4O6S/c32-21(24-26(34)37-29-31(24)19-9-5-2-6-10-19)15-38-27-28-20(25(33)30(27)18-7-3-1-4-8-18)13-17-11-12-22-23(14-17)36-16-35-22/h1-14H,15-16H2/p+1/b20-13+ |
| InChIKey | ZPZPVJDBZJZZHU-DEDYPNTBSA-O |
| XLogP | 3.33 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|