C14H13N3O8 — CID 177180351
3-[[2-carboxy-2-(2,5-dioxopyrrol-1-yl)ethyl]amino]-2-(2,5-dioxopyrrol-1-yl)propanoic acid (PubChem CID 177180351) has the molecular formula C14H13N3O8 and a molecular weight of 351.27 g/mol. Its IUPAC name is 3-[[2-carboxy-2-(2,5-dioxopyrrol-1-yl)ethyl]amino]-2-(2,5-dioxopyrrol-1-yl)propanoic acid.
| Compound Name | 3-[[2-carboxy-2-(2,5-dioxopyrrol-1-yl)ethyl]amino]-2-(2,5-dioxopyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 177180351 |
| Molecular Formula | C14H13N3O8 |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-[[2-carboxy-2-(2,5-dioxopyrrol-1-yl)ethyl]amino]-2-(2,5-dioxopyrrol-1-yl)propanoic acid |
| SMILES | O=C(O)C(CNCC(C(=O)O)N1C(=O)C=CC1=O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C14H13N3O8/c18-9-1-2-10(19)16(9)7(13(22)23)5-15-6-8(14(24)25)17-11(20)3-4-12(17)21/h1-4,7-8,15H,5-6H2,(H,22,23)(H,24,25) |
| InChIKey | BDNSZEUMTKYMNR-UHFFFAOYSA-N |
| XLogP | -2.67 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|