C8H12N2O4 — CID 142287139
2-(2,5-dioxopyrrolidin-1-yl)-3-(methylamino)propanoic acid (PubChem CID 142287139) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-3-(methylamino)propanoic acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-3-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 142287139 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-3-(methylamino)propanoic acid |
| SMILES | CNCC(C(=O)O)N1C(=O)CCC1=O |
| InChI | InChI=1S/C8H12N2O4/c1-9-4-5(8(13)14)10-6(11)2-3-7(10)12/h5,9H,2-4H2,1H3,(H,13,14) |
| InChIKey | AXHHHLWFWVGLKG-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|