C8H11NO3Se — CID 173433095
2-(2,5-dioxopyrrolidin-1-yl)butaneselenoic Se-acid (PubChem CID 173433095) has the molecular formula C8H11NO3Se and a molecular weight of 248.14 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)butaneselenoic Se-acid.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)butaneselenoic Se-acid |
|---|---|
| PubChem CID | 173433095 |
| Molecular Formula | C8H11NO3Se |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)butaneselenoic Se-acid |
| SMILES | CCC(C(=O)[SeH])N1C(=O)CCC1=O |
| InChI | InChI=1S/C8H11NO3Se/c1-2-5(8(12)13)9-6(10)3-4-7(9)11/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | UVLHYGSRBZTKSO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|