About (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate
(2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate (PubChem CID 7039487) has the molecular formula C9H9NO6-2
and a molecular weight of 227.17 g/mol. Its IUPAC name is (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate.
Molecular Properties
| Compound Name | (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate |
| PubChem CID | 7039487 |
| Molecular Formula | C9H9NO6-2 |
| Molecular Weight | 227.17 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate |
| SMILES | O=C([O-])CC[C@H](C(=O)[O-])N1C(=O)CCC1=O |
| InChI | InChI=1S/C9H11NO6/c11-6-2-3-7(12)10(6)5(9(15)16)1-4-8(13)14/h5H,1-4H2,(H,13,14)(H,15,16)/p-2/t5-/m1/s1 |
| InChIKey | VVPXCQJEIWWMEH-RXMQYKEDSA-L |
| XLogP | -3.22 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.17 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate?
The IUPAC name of (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate (CID 7039487) is (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate.
What is the SMILES notation for (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate?
The canonical SMILES for (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate is O=C([O-])CC[C@H](C(=O)[O-])N1C(=O)CCC1=O.
What is the InChIKey of (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate?
The InChIKey is VVPXCQJEIWWMEH-RXMQYKEDSA-L. The full InChI is InChI=1S/C9H11NO6/c11-6-2-3-7(12)10(6)5(9(15)16)1-4-8(13)14/h5H,1-4H2,(H,13,14)(H,15,16)/p-2/t5-/m1/s1.
What are the key properties of (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate?
(2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate has a molecular weight of 227.17 g/mol, XLogP of -3.22, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(2,5-dioxopyrrolidin-1-yl)pentanedioate is sourced from PubChem (CID 7039487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).