C8H11NO7S — CID 170315067
4-(2,5-dioxopyrrolidin-1-yl)-4-sulfobutanoic acid (PubChem CID 170315067) has the molecular formula C8H11NO7S and a molecular weight of 265.24 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrolidin-1-yl)-4-sulfobutanoic acid.
| Compound Name | 4-(2,5-dioxopyrrolidin-1-yl)-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 170315067 |
| Molecular Formula | C8H11NO7S |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 4-(2,5-dioxopyrrolidin-1-yl)-4-sulfobutanoic acid |
| SMILES | O=C(O)CCC(N1C(=O)CCC1=O)S(=O)(=O)O |
| InChI | InChI=1S/C8H11NO7S/c10-5-1-2-6(11)9(5)7(17(14,15)16)3-4-8(12)13/h7H,1-4H2,(H,12,13)(H,14,15,16) |
| InChIKey | OUSHLRHRVDAAQN-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|