C22H41NO5 — CID 175876863
1-hydroxypyrrolidine-2,5-dione;16-methylheptadecanoic acid (PubChem CID 175876863) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is 1-hydroxypyrrolidine-2,5-dione;16-methylheptadecanoic acid.
| Compound Name | 1-hydroxypyrrolidine-2,5-dione;16-methylheptadecanoic acid |
|---|---|
| PubChem CID | 175876863 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | 1-hydroxypyrrolidine-2,5-dione;16-methylheptadecanoic acid |
| SMILES | CC(C)CCCCCCCCCCCCCCC(=O)O.O=C1CCC(=O)N1O |
| InChI | InChI=1S/C18H36O2.C4H5NO3/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;6-3-1-2-4(7)5(3)8/h17H,3-16H2,1-2H3,(H,19,20);8H,1-2H2 |
| InChIKey | SJDFLTOMQWOJHL-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|